Home
Products
Grosvenorin
| Product Name | Grosvenorin |
| Price: | $219 / 5mg |
| Catalog No.: | CN05485 |
| CAS No.: | 156980-60-8 |
| Molecular Formula: | C33H40O19 |
| Molecular Weight: | 740.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Siraitia grosuenorii |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@H](Oc3cc(O)c4c(c3)oc(c(c4=O)O[C@@H]3O[C@@H](C)[C@@H]([C@H]([C@H]3O)O)O)c3ccc(cc3)O)O[C@H]([C@@H]([C@H]2O)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Grosvenorine is the major flavonoid compound of the fruits of Siraitia grosvenorii. Grosvenorine exhibits good antibacterial and antioxidant activities[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1067.8±65.0 °C at 760 mmHg |
| Flash Point | 336.8±27.8 °C |
| Exact Mass | 740.216370 |
| LogP | -0.65 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |