Home
Products
Hosenkoside C
| Product Name | Hosenkoside C |
| Price: | $321 / 5mg |
| Catalog No.: | CN07732 |
| CAS No.: | 156764-83-9 |
| Molecular Formula: | C48H82O20 |
| Molecular Weight: | 979.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Impatiens balsamina L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC(=CCCC1(CO)CCC2(C(C1O)CCC1C2(C)CCC2C1(C)CCC(C2(C)COC1OC(CO)C(C(C1O)O)O)OC1OC(CO)C(C(C1OC1OC(CO)C(C(C1O)O)O)O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hosenkoside C is a baccharane glycoside isolated from the seeds of Impatiens balsamina[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1075.1±65.0 °C at 760 mmHg |
| Flash Point | 604.0±34.3 °C |
| Exact Mass | 978.539917 |
| PSA | 338.60000 |
| LogP | 0.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |