Home
Products
Ryanodine
| Product Name | Ryanodine |
| Price: | Inquiry |
| Catalog No.: | CN08215 |
| CAS No.: | 15662-33-6 |
| Molecular Formula: | C25H35NO9 |
| Molecular Weight: | 493.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Sabadilla. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@H]1CC[C@]2([C@@]3([C@@H]1O)O[C@@]1([C@]4([C@@]3(O)[C@@]([C@@]2(C)C1)(O)[C@@H]([C@]4(O)C(C)C)OC(=O)c1[nH]ccc1)C)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ryanodine is a cell permeant ryanodine receptor modulator. Ryanodine can either stimulate or inhibit Ryanodine-mediated Ca2+ release depending on its concentrations. Poisonous diterpenoid found in Ryania speciosa. |
| Target | Ryanodine receptor[1] |
| In Vivo | Ryanodine (100-5000 nM, 30-120 mintutes) irreversibly depresses twitch and tetanic tension of both fast and slow muscle in a dose-related manner[1]. At concentrations above 250 nM, ryanodine induces a slowly developing, dose dependent contracture which could not be blocked by 5 mMCo2+[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 714.2±60.0 °C at 760 mmHg |
| Flash Point | 385.7±32.9 °C |
| Exact Mass | 493.231171 |
| PSA | 172.70000 |
| LogP | 3.86 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |