Home
Products
Vinaginsenoside R4
| Product Name | Vinaginsenoside R4 |
| Price: | Inquiry |
| Catalog No.: | CN07278 |
| CAS No.: | 156009-80-2 |
| Molecular Formula: | C48H82O19 |
| Molecular Weight: | 963.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax notoginseng |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)[C@H](O)C[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)(CCC=C(C)C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vinaginsenoside R4, isolated from the leaves of hydroponic Panax ginseng. It has an inhibitory effect on melanin biosynthesis without any cytotoxic effects on the melan-a cells, and enhances the depigmentation on the zebrafish[1]. |
| Density | 1.4±0.0 g/cm3 |
| Boiling Point | 1041.4±0.0 °C at 760 mmHg |
| Flash Point | 583.6±0.0 °C |
| Exact Mass | 962.544983 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |