Home
Products
Isomagnolone
| Product Name | Isomagnolone |
| Price: | $146 / 20mg |
| Catalog No.: | CN07009 |
| CAS No.: | 155709-41-4 |
| Molecular Formula: | C18H18O3 |
| Molecular Weight: | 282.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The barks of Illicium simonsii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CCc1ccc(c(c1)Oc1ccc(cc1)C(=O)CC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isomagnolone is isolated from Illicium burmanicum and has anti-inflammatory activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 414.4±45.0 °C at 760 mmHg |
| Flash Point | 146.9±22.2 °C |
| Exact Mass | 282.125580 |
| PSA | 46.53000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |