Home
Products
Alisol G
| Product Name | Alisol G |
| Price: | $380 / 5mg |
| Catalog No.: | CN07638 |
| CAS No.: | 155521-46-3 |
| Molecular Formula: | C30H48O4 |
| Molecular Weight: | 472.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The tubers of Alisma plantago-aquatica Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C)[C@@H]([C@H](C[C@H](C1=C2C[C@H](O)[C@@H]3[C@]([C@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alisol G is a natural product extracted from Rhizoma Alismatis. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 598.4±50.0 °C at 760 mmHg |
| Flash Point | 329.8±26.6 °C |
| Exact Mass | 472.355255 |
| LogP | 5.39 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Storage condition | 2-8℃ |