Home
Products
Alisol F
| Product Name | Alisol F |
| Price: | $366 / 10mg |
| Catalog No.: | CN07655 |
| CAS No.: | 155521-45-2 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The tubers of Alisma plantago-aquatica Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC2=C3[C@H](C)C[C@H](O[C@H]3C[C@@]2([C@@]2([C@@H]1[C@@]1(C)CCC(=O)C([C@@H]1CC2)(C)C)C)C)[C@H](C(O)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alisol F is a natural product. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 617.4±55.0 °C at 760 mmHg |
| Flash Point | 194.6±25.0 °C |
| Exact Mass | 488.350189 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Storage condition | 2-8℃ |