Home
Products
Usaramine
| Product Name | Usaramine |
| Price: | Inquiry |
| Catalog No.: | CN01477 |
| CAS No.: | 15503-87-4 |
| Molecular Formula: | C18H25NO6 |
| Molecular Weight: | 351.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Crotalaria mucronata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C/1C[C@@H](C)[C@](O)(CO)C(=O)OCC2=CCN3[C@H]2[C@H](OC1=O)CC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Usaramine is a pyrrolizidine alkaloid isolated from seeds of Crolatalaria pallida. Usaramine demonstrates a highlighted antibiofilm activity against Staphylococcus epidermidis by reducing more than 50% of biofilm formation without killing the bacteria[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 583.2±50.0 °C at 760 mmHg |
| Flash Point | 306.5±30.1 °C |
| Exact Mass | 351.168182 |
| PSA | 96.30000 |
| LogP | -0.14 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |