Home
Products
Rhaponiticin
| Product Name | Rhaponiticin |
| Price: | $46 / 20mg |
| Catalog No.: | CN04041 |
| CAS No.: | 155-58-8 |
| Molecular Formula: | C21H24O9 |
| Molecular Weight: | 420.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Rumex obtusifolius L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(/C=C/c3ccc(c(c3)O)OC)cc(c2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhapontin (Rhaponiticin), a component of rhubarb (Rheum officinale Baillon), induces apoptosis resulting in suppression of proliferation of human stomach cancer KATO III cells[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 749.3±60.0 °C at 760 mmHg |
| Flash Point | 406.9±32.9 °C |
| Exact Mass | 420.142029 |
| PSA | 149.07000 |
| LogP | 0.68 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |