Home
Products
4-Acetoxycinnamic acid
| Product Name | 4-Acetoxycinnamic acid |
| Price: | Inquiry |
| Catalog No.: | CN06985 |
| CAS No.: | 15486-19-8 |
| Molecular Formula: | C11H10O4 |
| Molecular Weight: | 206.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The barks of Cinnamomum cassia Presl |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C=Cc1ccc(cc1)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4-Acetoxycinnamic acid is an acetate ester obtained by the formal condensation of the hydroxy group of trans-4-coumaric acid with acetic acid. 4-Acetoxycinnamic acid is a member of cinnamic acids and a member of phenyl acetates. 4-Acetoxycinnamic acid derives from a trans-4-coumaric acid[1]. |
| Density | 1.267g/cm3 |
| Boiling Point | 209-211 |
| Flash Point | 144.4ºC |
| Exact Mass | 206.05800 |
| PSA | 63.60000 |
| LogP | 1.70970 |
| Vapour Pressure | 5.51E-06mmHg at 25°C |