Home
Products
Sinapaldehyde glucoside
| Product Name | Sinapaldehyde glucoside |
| Price: | Inquiry |
| Catalog No.: | CN07011 |
| CAS No.: | 154461-65-1 |
| Molecular Formula: | C17H22O9 |
| Molecular Weight: | 370.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The barks of Phellodendron amurense |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=CC=Cc1cc(OC)c(c(c1)OC)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 633.5±55.0 °C at 760 mmHg |
| Flash Point | 229.2±25.0 °C |
| Exact Mass | 370.126373 |
| PSA | 134.91000 |
| LogP | -1.51 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |