Home
Products
Fuscaxanthone C
| Product Name | Fuscaxanthone C |
| Price: | $526 / 10mg |
| Catalog No.: | CN05776 |
| CAS No.: | 15404-76-9 |
| Molecular Formula: | C26H30O6 |
| Molecular Weight: | 438.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c(c1CC=C(C)C)c(=O)c1c(o2)cc(c(c1O)CC=C(C)C)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Fuscaxanthone C is an xanthone isolated from the stem bark of Garcinia fusca[1]. |
| Density | 1.167g/cm3 |
| Boiling Point | 601.5ºC at 760mmHg |
| Flash Point | 199.6ºC |
| Exact Mass | 438.20400 |
| PSA | 78.13000 |
| LogP | 5.69500 |
| Vapour Pressure | 4.59E-15mmHg at 25°C |