Home
Products
Berberrubine
| Product Name | Berberrubine |
| Price: | $103 / 20mg |
| Catalog No.: | CN01218 |
| CAS No.: | 15401-69-1 |
| Molecular Formula: | C19H16NO4+ |
| Molecular Weight: | 322.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Coptis chinensis Franch. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1O)c[n+]1c(c2)c2cc3OCOc3cc2CC1.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Berberrubine chloride is an active metabolite of berberine, attenuates ulcerative colitis in mice model[1]. |
| Exact Mass | 357.076782 |
| PSA | 51.80000 |
| Vapour Pressure | 4.28E-15mmHg at 25°C |
| Storage condition | 2-8C |