Home
Products
Ipecoside
| Product Name | Ipecoside |
| Price: | Inquiry |
| Catalog No.: | CN03034 |
| CAS No.: | 15401-60-2 |
| Molecular Formula: | C27H35NO12 |
| Molecular Weight: | 565.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Psychotria ipecacuanha |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=CC1C(OC=C(C1CC1N(CCc2c1cc(O)c(c2)O)C(=O)C)C(=O)OC)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ipecoside is an alkaloid isolated from Psychotria[1]. |
| Density | 1.5g/cm3 |
| Boiling Point | 821.6ºC at 760 mmHg |
| Flash Point | 450.7ºC |
| Exact Mass | 565.21600 |
| PSA | 195.68000 |
| Vapour Pressure | 1.42E-28mmHg at 25°C |