Home
Products
1,5-Anhydro-D-glucitol
| Product Name | 1,5-Anhydro-D-glucitol |
| Price: | Inquiry |
| Catalog No.: | CN06661 |
| CAS No.: | 154-58-5 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 164.16 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | White cryst. |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1OC[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,5-Anhydrosorbitol is a short-term marker for glycemic control. |
| Target | Human Endogenous Metabolite |
| In Vitro | 1,5-Anhydrosorbitol can indicate that metabolite score marks individuals at higher risk for developing diabetes or insulin resistance and thereby coronary heart disease(CHD)[1]. |
| Density | 1.533 g/cm3 |
| Boiling Point | 376.8ºC at 760 mmHg |
| Flash Point | 181.7ºC |
| Exact Mass | 164.06800 |
| PSA | 90.15000 |
| Storage condition | -20°C Freezer |