Home
Products
Desmethoxy yangonin
| Product Name | Desmethoxy yangonin |
| Price: | $161 / 10mg |
| Catalog No.: | CN03961 |
| CAS No.: | 15345-89-8 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Piper methysticum Forst. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/c2ccccc2)oc(=O)c1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Desmethoxyyangonin is one of the six major kavalactones found in the Piper methysticum (kava) plant; reversible inhibitor of MAO-B. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 440.0±45.0 °C at 760 mmHg |
| Flash Point | 188.0±23.3 °C |
| Exact Mass | 228.078644 |
| PSA | 39.44000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8°C |