Home
Products
Taxol C
| Product Name | Taxol C |
| Price: | Inquiry |
| Catalog No.: | CN08431 |
| CAS No.: | 153415-45-3 |
| Molecular Formula: | C46H57NO14 |
| Molecular Weight: | 847.95 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Chinese yew Taxus chinensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCC(=O)NC(C(C(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3C(C(=O)C(C(=C1C)C2(C)C)OC(=O)C)(C)C(O)CC1C3(CO1)OC(=O)C)O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Paclitaxel C is a compound that can be found in taxus cutting[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 932.3±65.0 °C at 760 mmHg |
| Flash Point | 517.6±34.3 °C |
| Exact Mass | 847.377930 |
| PSA | 224.78000 |
| LogP | 7.22 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |