Home
Products
Ginkgolide K
| Product Name | Ginkgolide K |
| Price: | $219 / 20mg |
| Catalog No.: | CN08256 |
| CAS No.: | 153355-70-5 |
| Molecular Formula: | C20H22O9 |
| Molecular Weight: | 406.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OC2C(=C1C)C13C4(C2O)C(OC3=O)CC(C24C(O1)OC(=O)C2O)C(C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ginkgolide K, isolated from Ginkgo biloba, induces protective autophagy through the AMPK/mTOR/ULK1 signaling pathway. Ginkgolide K possesses neuroprotective activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 743.5±60.0 °C at 760 mmHg |
| Flash Point | 269.8±26.4 °C |
| Exact Mass | 406.126373 |
| LogP | 0.48 |
| Vapour Pressure | 0.0±5.6 mmHg at 25°C |