Home
Products
Rutin
| Product Name | Rutin |
| Price: | $18 / 20mg |
| Catalog No.: | CN05507 |
| CAS No.: | 153-18-4 |
| Molecular Formula: | C27H30O16 |
| Molecular Weight: | 610.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Styphnolobium japonicum (L.) Schott. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(c(c2=O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rutin, a naturally occurring flavonoid glycoside, has antioxidant, anti-inflammatory, anti-allergic, anti-angiogenic and antiviral properties. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 983.1±65.0 °C at 760 mmHg |
| Flash Point | 325.4±27.8 °C |
| Exact Mass | 610.153381 |
| PSA | 269.43000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |