Home
Products
Ginkgolide B
| Product Name | Ginkgolide B |
| Price: | $34 / 20mg |
| Catalog No.: | CN08903 |
| CAS No.: | 15291-77-7 |
| Molecular Formula: | C20H24O10 |
| Molecular Weight: | 424.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OC2C(C1C)(O)C13C4(C2O)C(OC3=O)CC(C24C(O1)OC(=O)C2O)C(C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ginkgolide B, an important active terpenoid from Ginkgo biloba leaves, is reported to increase cell viability and decrease cell apoptosis.IC50 value:Target:In vitro: Ginkgolide B (0.2 or 0.4 μg/ml) was added to the culture medium in vitro led to increases in cell viability and decreases in the number of hippocampal cells undergoing AAPH-induced apoptosis [1]. Ginkgolide B caused a dose-related protection against dysrhythmias; the antiarrhythmic effect of ginkgolide B was comparable to that of diltiazem and superior to the activity of metoprolol. Ginkgolide B can presumably prevent the re-entry mechanism involved in the development of ischemia-induced rhythm disturbances [2].In vivo: Oral administration of ginkgolide B (2 mg/kg/day, p.o.) caused a significant increase in cell viability and a highly significant decrease in the numbers of both spontaneously occurring and AAPH-induced apoptoses. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 762.4±60.0 °C at 760 mmHg |
| Flash Point | 274.3±26.4 °C |
| Exact Mass | 424.136932 |
| PSA | 148.82000 |
| LogP | 0.52 |
| Vapour Pressure | 0.0±5.8 mmHg at 25°C |
| Storage condition | 2-8°C |