Home
Products
Evocarpine
| Product Name | Evocarpine |
| Price: | $321 / 10mg |
| Catalog No.: | CN00922 |
| CAS No.: | 15266-38-3 |
| Molecular Formula: | C23H33NO |
| Molecular Weight: | 339.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | The fruits of Evodiae fructus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCC/C=CCCCCCCCc1cc(=O)c2c(n1C)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Evocarpine, a quinolone alkaloid that could be isolated from Evodiae fructus, inhibitss Ca2+ influx through voltage-dependent calcium channels. Antimycobacterial activity[1][2]. |
| In Vitro | Cumulative application of evocarpine (1-100 μM) inhibits the sustained contraction induced by 60 mM K+ in a concentration-dependent manner[1]. Evocarpine is found to induce apoptotic cell death in promyelocytic leukaemia HL‐60 cells in dose- and time-dependent manners[3]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 456.2±45.0 °C at 760 mmHg |
| Flash Point | 156.1±18.1 °C |
| Exact Mass | 339.256226 |
| PSA | 22.00000 |
| LogP | 7.70 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8C |