Home
Products
Buddlejasaponin IVb
| Product Name | Buddlejasaponin IVb |
| Price: | Inquiry |
| Catalog No.: | CN07557 |
| CAS No.: | 152580-79-5 |
| Molecular Formula: | C48H78O18 |
| Molecular Weight: | 943.12 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Clinopodium chinense. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(OC(C(C2OC2OC(CO)C(C(C2O)O)O)O)C)OC2CCC3(C(C2(C)CO)CCC2(C3C=CC3=C4CC(C)(C)CCC4(C(CC23C)O)CO)C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Buddlejasaponin IVb (Compound 2), a triterpene saponin isolated from Clinopodium chinense (Benth.) O. Kuntze, Compound 2 has hemostasis efficacy, shortens thrombin time (TT) by 20.6 %[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1054.2±65.0 °C at 760 mmHg |
| Flash Point | 591.3±34.3 °C |
| Exact Mass | 942.518799 |
| PSA | 298.14000 |
| LogP | 3.80 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8°C |