Home
Products
Vicine
| Product Name | Vicine |
| Price: | $176 / 20mg |
| Catalog No.: | CN00762 |
| CAS No.: | 152-93-2 |
| Molecular Formula: | C10H16N4O7 |
| Molecular Weight: | 304.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Vicia faba L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(N)[nH]c(nc2=O)N)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vicine, an alkaloid glycoside found mainly in fava beans, is toxic in individuals and may cause haemolytic anaemia[1]. |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 627.4±65.0 °C at 760 mmHg |
| Flash Point | 333.2±34.3 °C |
| Exact Mass | 304.101898 |
| PSA | 197.17000 |
| LogP | -2.55 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |