Home
Products
Borapetoside E
| Product Name | Borapetoside E |
| Price: | Inquiry |
| Catalog No.: | CN08486 |
| CAS No.: | 151200-49-6 |
| Molecular Formula: | C27H36O11 |
| Molecular Weight: | 536.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The vines of Tinospora crispa. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H](c2cocc2)C[C@]2(C)[C@H]3C[C@@H]([C@@]4([C@H]2CCC=C4C(=O)OC)C)OC3=O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 711.1±60.0 °C at 760 mmHg |
| Flash Point | 383.9±32.9 °C |
| Exact Mass | 536.225769 |
| PSA | 165.12000 |
| LogP | 0.55 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |