Home
Products
Micromelin
| Product Name | Micromelin |
| Price: | Inquiry |
| Catalog No.: | CN06300 |
| CAS No.: | 15085-71-9 |
| Molecular Formula: | C15H12O6 |
| Molecular Weight: | 288.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Micromelum integerrimum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(=O)ccc2cc1[C@H]1OC(=O)[C@]2([C@@H]1O2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Micromelin is a coumarin from Micromelum minutum (Forst. f.) Seem (family Rutaceae)[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 513.0±50.0 °C at 760 mmHg |
| Flash Point | 232.0±30.2 °C |
| Exact Mass | 288.063385 |
| PSA | 78.27000 |
| LogP | 0.17 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |