Home
Products
Poncirin
| Product Name | Poncirin |
| Price: | $190 / 10mg |
| Catalog No.: | CN05166 |
| CAS No.: | 14941-08-3 |
| Molecular Formula: | C28H34O14 |
| Molecular Weight: | 594.56 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Poncirus trifoliata (L.) Raf. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3O[C@@H](CC(=O)c3c(c2)O)c2ccc(cc2)OC)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Poncirin is isolated from Poncirus trifoliata with anti-inflammory activites. Poncirin significantly reduces mechanical hyperalgesia and allodynia in Complete Freund’s Adjuvant (CFA)-induced inflammatory pain models[1]. |
| In Vivo | Poncirin (intraperitoneal administration; 30 mg/kg) markedly reduces the pain behavior in both acetic acid-induced visceral pain and formalin-induced tonic pain models inComplete Freund’s Adjuvant (CFA)-induced inflammatory pain model[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 900.1±65.0 °C at 760 mmHg |
| Flash Point | 296.5±27.8 °C |
| Exact Mass | 594.194885 |
| PSA | 214.06000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |