Home
Products
1,2,3,4,6-O-Pentagalloylglucose
| Product Name | 1,2,3,4,6-O-Pentagalloylglucose |
| Price: | $68 / 20mg |
| Catalog No.: | CN03947 |
| CAS No.: | 14937-32-7 |
| Molecular Formula: | C41H32O26 |
| Molecular Weight: | 940.68 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(c1cc(O)c(c(c1)O)O)O[C@@H]1OC(COC(=O)c2cc(O)c(c(c2)O)O)[C@H]([C@@H]([C@@H]1OC(=O)c1cc(O)c(c(c1)O)O)OC(=O)c1cc(O)c(c(c1)O)O)OC(=O)c1cc(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,2,3,4,6-Penta-O-galloyl-β-D-glucopyranose is a gallotannin isolated from various plants. It suppressed interleukin (IL)-4 induced signal pathway in B cell, and inhibited IgE production partially caused by increasing a population of Treg cells in conjunction with Treg-inducing factors. |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 1365.7±65.0 °C at 760 mmHg |
| Flash Point | 410.4±27.8 °C |
| Exact Mass | 940.118164 |
| PSA | 444.18000 |
| LogP | 8.51 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |