Home
Products
Cratoxylone
| Product Name | Cratoxylone |
| Price: | $293 / 5mg |
| Catalog No.: | CN05775 |
| CAS No.: | 149155-01-1 |
| Molecular Formula: | C24H28O7 |
| Molecular Weight: | 428.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c(c1CC=C(C)C)c(=O)c1c(o2)cc(c(c1O)CCC(O)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cratoxylone, isolated from the bark of Cratoxylum Cochinchinense, possesses antiplasmodial activity[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 674.2±55.0 °C at 760 mmHg |
| Flash Point | 231.2±25.0 °C |
| Exact Mass | 428.183502 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |