Home
Products
Epigallocatechin gallate octaacetate
| Product Name | Epigallocatechin gallate octaacetate |
| Price: | Inquiry |
| Catalog No.: | CN04236 |
| CAS No.: | 148707-39-5 |
| Molecular Formula: | C38H34O19 |
| Molecular Weight: | 794.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The woods of Acacia catechu |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1cc(OC(=O)C)c2c(c1)O[C@@H]([C@@H](C2)OC(=O)c1cc(OC(=O)C)c(c(c1)OC(=O)C)OC(=O)C)c1cc(OC(=O)C)c(c(c1)OC(=O)C)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | EGCG Octaacetate is a prodrug of Green tea epigallocatechin-3-gallate (EGCG), utilized to enhance the stability and bioavailability of EGCG in vivo. EGCG Octaacetate has high efficacy, bioavailability, anti-oxidation and anti-angiogenesis capacities[1]. EGCG octaacetate is the potential antibacterial compound for gram-positive bacteria (GPB) and gram-negative bacteria (GNB) [2]. |
| Density | 1.46±0.1 g/cm3(Predicted) |
| Boiling Point | 879.7±65.0 °C(Predicted) |
| Exact Mass | 794.16900 |
| PSA | 245.93000 |
| LogP | 3.99080 |