Home
Products
3-O-Methylquercetin
| Product Name | 3-O-Methylquercetin |
| Price: | $556 / 10mg |
| Catalog No.: | CN05516 |
| CAS No.: | 1486-70-0 |
| Molecular Formula: | C16H12O7 |
| Molecular Weight: | 316.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Croton cascarilloides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(oc2c(c1=O)c(O)cc(c2)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Methylquercetin (3-MQ), a main constituent of Rhamnus nakaharai, inhibits total cAMP and cGMP-phosphodiesterase (PDE) of guinea pig trachealis. 3-O-Methylquercetin (3-MQ) exhibits IC50 values of 31.9 μM， 86.9 μM， 18.6 μM and 1.6 μM for PDE1, PDE5, PDE2 and PDE4, respectively[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 643.0±55.0 °C at 760 mmHg |
| Flash Point | 244.7±25.0 °C |
| Exact Mass | 316.058289 |
| PSA | 120.36000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |