Home
Products
Cyclo(Phe-Pro)
| Product Name | Cyclo(Phe-Pro) |
| Price: | Inquiry |
| Catalog No.: | CN01362 |
| CAS No.: | 14705-60-3 |
| Molecular Formula: | C14H16N2O2 |
| Molecular Weight: | 244.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Pantoea agglomerans |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1NC(Cc2ccccc2)C(=O)N2C1CCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyclo(Phe-Pro) (Cyclo(phenylalanylprolyl)), a Vibrio vulnificus quorum-sensing molecule, inhibits retinoic acid-inducible gene-I (RIG-I) polyubiquitination, through its specific interaction with RIG-I, to blunt IRF-3 activation and type-I IFN production. Cyclo(Phe-Pro) (Cyclo(phenylalanylprolyl)) enhances susceptibility to hepatitis C virus (HCV), as well as Sendai and influenza viruses[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 509.5±39.0 °C at 760 mmHg |
| Flash Point | 262.0±27.1 °C |
| Exact Mass | 244.121185 |
| LogP | -0.56 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |