Home
Products
Pulchinenoside E1
| Product Name | Pulchinenoside E1 |
| Price: | $141 / 10mg |
| Catalog No.: | CN07316 |
| CAS No.: | 146100-02-9 |
| Molecular Formula: | C53H86O22 |
| Molecular Weight: | 1075.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The flowers of Lonicera japonica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)[C@H](O[C@H]3[C@@H](OC[C@@H]([C@@H]3O)O)O[C@H]3CC[C@]4([C@H]([C@]3(C)CO)CC[C@@]3([C@@H]4CC=C4[C@@]3(C)CC[C@@]3([C@H]4CC(C)(C)CC3)C(=O)O)C)C)O[C@H]([C@@H]2O)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Macranthoside B, isolated from Flos Lonicerae, possesses anti-bacterial activity[1]. |