Home
Products
3-O-Acetyl-11-hydroxy-beta-boswellic acid
| Product Name | 3-O-Acetyl-11-hydroxy-beta-boswellic acid |
| Price: | $629 / 5mg |
| Catalog No.: | CN07247 |
| CAS No.: | 146019-25-2 |
| Molecular Formula: | C32H50O5 |
| Molecular Weight: | 514.74 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Boswellia carterii Birdw. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1CC[C@]2([C@H]([C@@]1(C)C(=O)O)CC[C@@]1([C@@H]2[C@H](O)C=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@H](C)CC1)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Acetyl-11-hydroxy-beta-boswellic acid is a potent 5-lipoxygenase (5-LO) inhibitor[1]. |
| Target | 5-LOX |