Home
Products
Xanthosine
| Product Name | Xanthosine |
| Price: | Inquiry |
| Catalog No.: | CN00077 |
| CAS No.: | 146-80-5 |
| Molecular Formula: | C10H12N4O6 |
| Molecular Weight: | 284.23 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1[nH]c(=O)[nH]c2=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xanthosine is a nucleoside derived from xanthine and ribose. |
| Target | Human Endogenous Metabolite |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 828.2±75.0 °C at 760 mmHg |
| Flash Point | 454.7±37.1 °C |
| Exact Mass | 284.075684 |
| PSA | 153.46000 |
| LogP | -2.43 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |