Home
Products
Heterophyllin B
| Product Name | Heterophyllin B |
| Price: | $103 / 10mg |
| Catalog No.: | CN01091 |
| CAS No.: | 145459-19-4 |
| Molecular Formula: | C40H58N8O8 |
| Molecular Weight: | 778.95 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Pseudostellaria heterophylla. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@H]([C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@@H](NC1=O)Cc1ccccc1)CC(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Heterophyllin B is an active cyclic peptide isolated from Pseudostellaria heterophylla. Heterophyllin B provides a novel strategy for the treatment of esophageal cancer[1]. |
| In Vitro | Heterophyllin B (0-200 µM; 12-48 hours) reduces cell viability in the 75, 100 and 200 µM groups, has no effect on 5, 10, 25 and 50 µM groups[1]. Heterophyllin B (0-50 µM; 6 hours) suppresses the expression levels of p-PI3K, p-AKT and β-catenin in a dose-dependent manner in ECA-109 cells[1]. Cell Viability Assay[1] Cell Line: ECA-109 cells Concentration: 5 µM, 10 µM, 25 µM, 50 µM, 75 µM, 100 µM and 200 µM Incubation Time: 12, 24 and 48 hours Result: Decreased cell viability at high concentrations. Western Blot Analysis[1] Cell Line: ECA-109 cells Concentration: 0 µM, 10 µM, 25 µM, 50 µM Incubation Time: 6 hours Result: Decreased the phosphorylation of PI3K/AKT and the expression of β-catenin. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 1159.7±65.0 °C at 760 mmHg |
| Flash Point | 655.1±34.3 °C |
| Exact Mass | 778.437744 |
| PSA | 223.88000 |
| LogP | -1.82 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |