Home
Products
Isochlorogenic acid B
| Product Name | Isochlorogenic acid B |
| Price: | $62 / 20mg |
| Catalog No.: | CN07038 |
| CAS No.: | 14534-61-3 |
| Molecular Formula: | C25H24O12 |
| Molecular Weight: | 516.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The flowerbud of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H]1[C@H](O)C[C@@](C[C@H]1OC(=O)C=Cc1ccc(c(c1)O)O)(O)C(=O)O)C=Cc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,4-Dicaffeoylquinic acid is a reference substance of a common phytochemical found in Echinacea (Echinacea sp.); dietary supplement, herb, or plant testing applications with this reference material include material characterization, adulterant identification, or method validation. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 820.8±65.0 °C at 760 mmHg |
| Flash Point | 278.5±27.8 °C |
| Exact Mass | 516.126770 |
| PSA | 211.28000 |
| LogP | 0.72 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | ?20°C |