Home
Products
Sodium taurocholate
| Product Name | Sodium taurocholate |
| Price: | Inquiry |
| Catalog No.: | CN02272 |
| CAS No.: | 145-42-6 |
| Molecular Formula: | C26H44NNaO7S |
| Molecular Weight: | 537.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC[C@]2([C@@H](C1)C[C@H]([C@@H]1[C@@H]2C[C@H](O)[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)NCCS(=O)(=O)[O-])C)C)O)C.[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Taurocholic acid sodium (Sodium taurocholate; N-Choloyltaurine sodium) has marked bioactive effects such as an inhibitory potential against hepatic artery ligation induced biliary damage by upregulation of VEGF-A expression. Immunoregulation effect[1]. |
| Target | Microbial Metabolite Human Endogenous Metabolite |
| Exact Mass | 537.273621 |
| PSA | 155.37000 |
| LogP | 3.49720 |