Home
Products
Licochalcone D
| Product Name | Licochalcone D |
| Price: | Inquiry |
| Catalog No.: | CN05617 |
| CAS No.: | 144506-15-0 |
| Molecular Formula: | C21H22O5 |
| Molecular Weight: | 354.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza glabra L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(/C=C/C(=O)c2ccc(c(c2)CC=C(C)C)O)ccc(c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licochalcone D, a flavonoid compound mainly existing in the root of Glycyrrhiza inflate, is a potent inhibitor of NF-kappaB (NF-κB) p65. Licochalcone D possesses antioxidant, anti-inflammatory, anti-cancer properties[1][2]. |
| Target | p65 |
| Exact Mass | 354.14700 |
| PSA | 86.99000 |
| LogP | 4.21680 |
| Storage condition | 2-8℃ |