Home
Products
Indoxacarb
| Product Name | Indoxacarb |
| Price: | Inquiry |
| Catalog No.: | CN06620 |
| CAS No.: | 144171-61-9 |
| Molecular Formula: | C22H17ClF3N3O7 |
| Molecular Weight: | 527.83 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Cryst. |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)N(C(=O)N1COC2(C(=N1)c1ccc(cc1C2)Cl)C(=O)OC)c1ccc(cc1)OC(F)(F)F |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Indoxacarb ((±)-Indoxacarb) is a broad-spectrum oxadiazine insecticide. Indoxacarb is metabolized in vivo to its active N-decarbomethoxyllated metabolite DCJW. Indoxacarb suppresses voltage-gated sodium channel currents in rat dorsal root ganglion neurons. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 571.4±60.0 °C at 760 mmHg |
| Flash Point | 299.3±32.9 °C |
| Exact Mass | 527.070740 |
| PSA | 106.97000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |