Home
Products
Kaempferol 3,4,7-triacetate
| Product Name | Kaempferol 3,4,7-triacetate |
| Price: | Inquiry |
| Catalog No.: | CN05537 |
| CAS No.: | 143724-69-0 |
| Molecular Formula: | C21H16O9 |
| Molecular Weight: | 412.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cudrania tricuspidata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1ccc(cc1)c1oc2cc(OC(=O)C)cc(c2c(=O)c1OC(=O)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 600.1±55.0 °C at 760 mmHg |
| Flash Point | 211.8±25.0 °C |
| Exact Mass | 412.079437 |
| PSA | 129.34000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |