Home
Products
Shancigusin I
| Product Name | Shancigusin I |
| Price: | $277 / 5mg |
| Catalog No.: | CN03463 |
| CAS No.: | 1435488-35-9 |
| Molecular Formula: | C28H34O14 |
| Molecular Weight: | 594.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Cremastra appendiculata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2ccc(cc2)COC(=O)C=Cc2ccc(cc2)OC2OC(CO)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Shancigusin I is a natural compound found in Cremastra appendiculata[1]. |
| Density | 1.543±0.06 g/cm3(Predicted) |
| Boiling Point | 888.7±65.0 °C(Predicted) |