Home
Products
Hydroquinidine
| Product Name | Hydroquinidine |
| Price: | Inquiry |
| Catalog No.: | CN00761 |
| CAS No.: | 1435-55-8 |
| Molecular Formula: | C20H26N2O2 |
| Molecular Weight: | 326.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Cinchona ledgeriana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](c1ccnc2c1cc(OC)cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroquinidine is an antiarrhythmic agent. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 498.4±30.0 °C at 760 mmHg |
| Flash Point | 255.2±24.6 °C |
| Exact Mass | 326.199432 |
| PSA | 45.59000 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |