Home
Products
Cnidilin
| Product Name | Cnidilin |
| Price: | $409 / 5mg |
| Catalog No.: | CN06151 |
| CAS No.: | 14348-22-2 |
| Molecular Formula: | C17H16O5 |
| Molecular Weight: | 300.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica dahurica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2occc2c(c2c1oc(=O)cc2)OCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cnidilin (Knidilin) is isolated from the root of Angelica dahurica[1]. |
| Density | 1.243 |
| Boiling Point | 480.4±45.0 °C at 760 mmHg |
| Flash Point | 244.4±28.7 °C |
| Exact Mass | 300.099762 |
| PSA | 61.81000 |
| LogP | 4.19 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8℃ |