Home
Products
Salvianolic acid D
| Product Name | Salvianolic acid D |
| Price: | $409 / 5mg |
| Catalog No.: | CN06932 |
| CAS No.: | 142998-47-8 |
| Molecular Formula: | C20H18O10 |
| Molecular Weight: | 492.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H](C(=O)O)Cc1ccc(c(c1)O)O)/C=C/c1ccc(c(c1CC(=O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Salvianolic acid D, isolated from Salvia miltiorrhiza, is a potential antiplatelet activity compound[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 786.9±60.0 °C at 760 mmHg |
| Flash Point | 280.2±26.4 °C |
| Exact Mass | 418.089996 |
| LogP | 0.98 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |