Home
Products
Petunidin chloride
| Product Name | Petunidin chloride |
| Price: | Inquiry |
| Catalog No.: | CN05135 |
| CAS No.: | 1429-30-7 |
| Molecular Formula: | C16H13ClO7 |
| Molecular Weight: | 352.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(cc(c1O)O)c1[o+]c2cc(O)cc(c2cc1O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Petunidin chloride is an O-methylated anthocyanidin derived from delphinidin that imparts blue-red pigments to flowers, fruits, and red wine. Petunidin chloride binds with and suppresses the activity of focal adhesion kinase and to inhibit platelet-derived growth factor-induced aortic smooth muscle cell migration, which may confer a protective effect against atherosclerosis. |
| Density | 1.3212 (rough estimate) |
| Boiling Point | 376.58°C (rough estimate) |
| Exact Mass | 352.03500 |
| PSA | 123.52000 |
| Storage condition | ?20°C |