Home
Products
Isosilybin B
| Product Name | Isosilybin B |
| Price: | $158 / 5mg |
| Catalog No.: | CN04472 |
| CAS No.: | 142796-22-3 |
| Molecular Formula: | C25H22O10 |
| Molecular Weight: | 482.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Silybum marianum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H]1Oc2cc(ccc2O[C@H]1c1ccc(c(c1)OC)O)[C@H]1Oc2cc(O)cc(c2C(=O)[C@@H]1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isosilybin B, a flavonolignan isolated from silymarin, has anti-prostate cancer (PCA) activity via inhibiting proliferation and inducing G1 phase arrest and apoptosis. Isosilybin B causes androgen receptor (AR) degradation[1][2]. |
| Density | 1.527±0.06 g/cm3(Predicted) |
| Boiling Point | 793.0±60.0 °C(Predicted) |
| Exact Mass | 482.12100 |
| PSA | 155.14000 |
| LogP | 2.36270 |
| Storage condition | 2-8℃ |