Home
Products
Anemarsaponin BIII
| Product Name | Anemarsaponin BIII |
| Price: | $293 / 10mg |
| Catalog No.: | CN02414 |
| CAS No.: | 142759-74-8 |
| Molecular Formula: | C45H74O18 |
| Molecular Weight: | 903.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Anemarrhena asphodeloides Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCCCCCC(CC=CCCCCCCCC(=O)OCC(CO)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Timosaponin B III is a major bioactive steroidal saponin isolated from Anemarrhena asphodeloides Bge, and exhibits anti-inflammatory, anti-platelet aggregative and anti-depressive effects[1][2][3]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1023.7±65.0 °C at 760 mmHg |
| Flash Point | 572.9±34.3 °C |
| Exact Mass | 902.487488 |
| PSA | 287.14000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |