Home
Products
6-Hydroxykaempferol 3,6-diglucoside
| Product Name | 6-Hydroxykaempferol 3,6-diglucoside |
| Price: | $234 / 5mg |
| Catalog No.: | CN05050 |
| CAS No.: | 142674-16-6 |
| Molecular Formula: | C27H30O17 |
| Molecular Weight: | 626.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Chrysactinia tinctorius |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2c(O)cc3c(c2O)c(=O)c(c(o3)c2ccc(cc2)O)OC2OC(CO)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6-Hydroxykaempferol 3,6-diglucoside possesses antiplatelet aggregatory effect[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 1049.0±65.0 °C at 760 mmHg |
| Flash Point | 345.6±27.8 °C |
| Exact Mass | 626.148315 |
| LogP | -1.28 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |