Home
Products
Daphylloside
| Product Name | Daphylloside |
| Price: | $467 / 5mg |
| Catalog No.: | CN03179 |
| CAS No.: | 14260-99-2 |
| Molecular Formula: | C19H26O12 |
| Molecular Weight: | 446.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Daphniphyllum macropodum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2C(=C[C@@H]3O)COC(=O)C)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Daphylloside is an iridoid isolated from the aerial parts of Galium verum. |
| In Vitro | Daphylloside may show some antioxidant effects. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 678.3±55.0 °C at 760 mmHg |
| Flash Point | 237.7±25.0 °C |
| Exact Mass | 446.142426 |
| PSA | 181.44000 |
| LogP | -2.47 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Storage condition | 2-8℃ |