Home
Products
Deacetylasperulosidic acid
| Product Name | Deacetylasperulosidic acid |
| Price: | $71 / 10mg |
| Catalog No.: | CN03104 |
| CAS No.: | 14259-55-3 |
| Molecular Formula: | C16H22O11 |
| Molecular Weight: | 390.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedyotis diffusa Willd. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1=C[C@@H]([C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deacetylasperulosidic acid (DAA) is a major phytochemical constituent of Morinda citrifolia fruit. Deacetylasperulosidic acidhas antioxidant activity by increasing superoxide dismutase activity. Deacetylasperulosidic acid has anticlastogenic activity, suppressing the induction of chromosome aberrations in hamster ovary cells and mice[1]. Deacetylasperulosidic acid prevents 4-nitroquinoline 1-oxide (4NQO) induced DNA damage in vitro, suppresses IL-2 production along with the activation of natural killer cells[2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 744.1±60.0 °C at 760 mmHg |
| Flash Point | 271.7±26.4 °C |
| Exact Mass | 390.116211 |
| PSA | 186.37000 |
| LogP | -2.48 |
| Vapour Pressure | 0.0±5.6 mmHg at 25°C |